CAS 1821-33-6 is the registry number for 3-Benzoyl-1-phenylurea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-(phenylcarbamoyl)benzamide (CAS 1821-33-6) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: N-(phenylcarbamoyl)benzamide. InChIKey: ZWYSLPOHOBPSLC-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | N-(phenylcarbamoyl)benzamide |
| InChIKey | ZWYSLPOHOBPSLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)