Products 1821782-12-0
CAS 1821782-12-0 is the registry number for ((1S,2R)-2-(4-Chlorophenyl)cyclopropyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2R)-2-(4-chlorophenyl)cyclopropyl]methanol (CAS 1821782-12-0) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: [(1S,2R)-2-(4-chlorophenyl)cyclopropyl]methanol. InChIKey: RHLUDCBNPQCUQK-SCZZXKLOSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | [(1S,2R)-2-(4-chlorophenyl)cyclopropyl]methanol |
| InChIKey | RHLUDCBNPQCUQK-SCZZXKLOSA-N |
| SMILES | C1[C@@H]([C@@H]1C2=CC=C(C=C2)Cl)CO |
Computed by PubChem (NCBI)