Products 388631-88-7
CAS 388631-88-7 is the registry number for [(1S,2S)-2-(4-chlorophenyl)cyclopropyl]methanol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(1S,2S)-2-(4-chlorophenyl)cyclopropyl]methanol (CAS 388631-88-7) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: [(1S,2S)-2-(4-chlorophenyl)cyclopropyl]methanol. InChIKey: RHLUDCBNPQCUQK-PSASIEDQSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | [(1S,2S)-2-(4-chlorophenyl)cyclopropyl]methanol |
| InChIKey | RHLUDCBNPQCUQK-PSASIEDQSA-N |
| SMILES | C1[C@@H]([C@H]1C2=CC=C(C=C2)Cl)CO |
Computed by PubChem (NCBI)