CAS 1821794-05-1 appears in our catalog under these names: methyl (3S,4S)-4-(trifluoromethyl)pyrrolidine-3-carboxylate hydrochloride, 97%, methyl (3S,4S)-4-(trifluoromethyl)pyrrolidine-3-carboxylate hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
Methyl (3S,4S)-4-(trifluoromethyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 1821794-05-1) is a chemical compound with the molecular formula C7H11ClF3NO2 and a molecular weight of 233.61 g/mol. IUPAC name: methyl (3S,4S)-4-(trifluoromethyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: RQQYZTONTAQRGS-TYSVMGFPSA-N.
| Molecular formula | C7H11ClF3NO2 |
|---|---|
| Molecular weight | 233.61 g/mol |
| IUPAC name | methyl (3S,4S)-4-(trifluoromethyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | RQQYZTONTAQRGS-TYSVMGFPSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@H]1C(F)(F)F.Cl |
Computed by PubChem (NCBI)