CAS 182205-62-5 is the registry number for 5,6-Dihydroxy-2-naphthalenecarboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
5,6-dihydroxynaphthalene-2-carboxylic acid (CAS 182205-62-5) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 5,6-dihydroxynaphthalene-2-carboxylic acid. InChIKey: ICGAFQWZWKIUMN-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 5,6-dihydroxynaphthalene-2-carboxylic acid |
| InChIKey | ICGAFQWZWKIUMN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2O)O)C=C1C(=O)O |
Computed by PubChem (NCBI)