CAS 1822348-61-7 is the registry number for 2-{((tert-Butoxy)carbonyl)amino}-2-(1-methylcyclopropyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1-methylcyclopropyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1822348-61-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 2-(1-methylcyclopropyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: YIVOXOHBBPCXTC-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 2-(1-methylcyclopropyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | YIVOXOHBBPCXTC-UHFFFAOYSA-N |
| SMILES | CC1(CC1)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)