Products 1822475-70-6

CAS 1822475-70-6 is the registry number for 3-BROMO-N-BOC-DL-PHENYLALANINE METHYL ESTER, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 1822475-70-6) is a chemical compound with the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. IUPAC name: methyl 3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: JHHCHYFRSFBCIU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20BrNO4
Molecular weight358.23 g/mol
IUPAC namemethyl 3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
InChIKeyJHHCHYFRSFBCIU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC1=CC(=CC=C1)Br)C(=O)OC

Computed by PubChem (NCBI)