CAS 1822476-05-0 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(oxazol-5-yl)propanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1,3-oxazol-5-yl)propanoic acid (CAS 1822476-05-0) is a chemical compound with the molecular formula C21H18N2O5 and a molecular weight of 378.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1,3-oxazol-5-yl)propanoic acid. InChIKey: VKKCGLUGHSLCQU-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O5 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1,3-oxazol-5-yl)propanoic acid |
| InChIKey | VKKCGLUGHSLCQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CN=CO4)C(=O)O |
Computed by PubChem (NCBI)