CAS 69027-03-8 is the registry number for Benzhydryl 2-(2-amino-2-oxoacetamido)-2-(furan-2-yl)acetate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Benzhydryl 2-(furan-2-yl)-2-(oxamoylamino)acetate (CAS 69027-03-8) is a chemical compound with the molecular formula C21H18N2O5 and a molecular weight of 378.4 g/mol. IUPAC name: benzhydryl 2-(furan-2-yl)-2-(oxamoylamino)acetate. InChIKey: VYWGGNWSGDPVPG-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O5 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | benzhydryl 2-(furan-2-yl)-2-(oxamoylamino)acetate |
| InChIKey | VYWGGNWSGDPVPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)OC(=O)C(C3=CC=CO3)NC(=O)C(=O)N |
Computed by PubChem (NCBI)