Products 2055119-21-4
CAS 2055119-21-4 is the registry number for Benzyl N-[2-(benzyloxy)-3-nitrophenyl]carbamate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzyl N-(3-nitro-2-phenylmethoxyphenyl)carbamate (CAS 2055119-21-4) is a chemical compound with the molecular formula C21H18N2O5 and a molecular weight of 378.4 g/mol. IUPAC name: benzyl N-(3-nitro-2-phenylmethoxyphenyl)carbamate. InChIKey: QNXUEBWDJTZOKT-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O5 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | benzyl N-(3-nitro-2-phenylmethoxyphenyl)carbamate |
| InChIKey | QNXUEBWDJTZOKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)