CAS 344768-30-5 appears in our catalog under these names: Rel-(2R,3S)-1-(phenanthrene-3-carbonyl)piperazine-2,3-dicarboxylic acid, 98%, cis-1-(Phenanthrene-3-carbonyl)-piperazine-2,3-dicarboxylic Acid, UBP141. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 1g, 10mg, 25mg, 50mg, Get quote.
(2R,3S)-1-(phenanthrene-3-carbonyl)piperazine-2,3-dicarboxylic acid (CAS 344768-30-5) is a chemical compound with the molecular formula C21H18N2O5 and a molecular weight of 378.4 g/mol. IUPAC name: (2R,3S)-1-(phenanthrene-3-carbonyl)piperazine-2,3-dicarboxylic acid. InChIKey: VVUAQPXBYDYTDF-ZWKOTPCHSA-N.
| Molecular formula | C21H18N2O5 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | (2R,3S)-1-(phenanthrene-3-carbonyl)piperazine-2,3-dicarboxylic acid |
| InChIKey | VVUAQPXBYDYTDF-ZWKOTPCHSA-N |
| SMILES | C1CN([C@H]([C@H](N1)C(=O)O)C(=O)O)C(=O)C2=CC3=C(C=CC4=CC=CC=C43)C=C2 |
Computed by PubChem (NCBI)