Products 1822572-56-4
CAS 1822572-56-4 is the registry number for (Rac)-Azide-phenylalanine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-3-(3-azidophenyl)propanoic acid (CAS 1822572-56-4) is a chemical compound with the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. IUPAC name: 2-amino-3-(3-azidophenyl)propanoic acid. InChIKey: BVCKZFDZBDTBTI-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 2-amino-3-(3-azidophenyl)propanoic acid |
| InChIKey | BVCKZFDZBDTBTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N=[N+]=[N-])CC(C(=O)O)N |
Computed by PubChem (NCBI)