Products 1822602-84-5
CAS 1822602-84-5 is the registry number for 1-Methylcyclohexane-1,3-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methylcyclohexane-1,3-dicarboxylic acid (CAS 1822602-84-5) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: 1-methylcyclohexane-1,3-dicarboxylic acid. InChIKey: VGMTUHUUJVRBPS-UHFFFAOYSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 1-methylcyclohexane-1,3-dicarboxylic acid |
| InChIKey | VGMTUHUUJVRBPS-UHFFFAOYSA-N |
| SMILES | CC1(CCCC(C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)