CAS 1822613-03-5 appears in our catalog under these names: 3-{((tert-butoxy)carbonyl)amino}-2-(propan-2-yl)butanoic acid, 95%, 3-{((tert-Butoxy)carbonyl)amino}-2-(propan-2-yl)butanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]butanoic acid (CAS 1822613-03-5) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: 3-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]butanoic acid. InChIKey: LZBYZAYOBAYHGM-UHFFFAOYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | 3-methyl-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]butanoic acid |
| InChIKey | LZBYZAYOBAYHGM-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(C)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)