Products 1822630-55-6

CAS 1822630-55-6 is the registry number for Ethyl 2-ethyl-5-fluorobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-ethyl-5-fluorobenzoate (CAS 1822630-55-6) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: ethyl 2-ethyl-5-fluorobenzoate. InChIKey: BDTAXCBWUPMYTE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13FO2
Molecular weight196.22 g/mol
IUPAC nameethyl 2-ethyl-5-fluorobenzoate
InChIKeyBDTAXCBWUPMYTE-UHFFFAOYSA-N
SMILESCCC1=C(C=C(C=C1)F)C(=O)OCC

Computed by PubChem (NCBI)