Products 1822666-91-0

CAS 1822666-91-0 is the registry number for 5-Bromo-8-methylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1822666-91-0) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: 5-bromo-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: BRBAPTOOXXWYRU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BrO3
Molecular weight271.11 g/mol
IUPAC name5-bromo-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyBRBAPTOOXXWYRU-UHFFFAOYSA-N
SMILESCC1=C2C(=C(C=C1)Br)CC(CO2)C(=O)O

Computed by PubChem (NCBI)