CAS 2090979-91-0 is the registry number for (S)-5-Bromo-8-methylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-5-bromo-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 2090979-91-0) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: (3S)-5-bromo-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: BRBAPTOOXXWYRU-ZETCQYMHSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | (3S)-5-bromo-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | BRBAPTOOXXWYRU-ZETCQYMHSA-N |
| SMILES | CC1=C2C(=C(C=C1)Br)C[C@@H](CO2)C(=O)O |
Computed by PubChem (NCBI)