CAS 182292-02-0 appears in our catalog under these names: 4-(Aminomethyl)-2-chlorobenzonitrile hydrochloride, 4-(Aminomethyl)-2-chlorobenzonitrile hydrochloride, 95%, 95%, 4-(aminomethyl)-2-chlorobenzonitrile hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
4-(aminomethyl)-2-chlorobenzonitrile;hydrochloride (CAS 182292-02-0) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 4-(aminomethyl)-2-chlorobenzonitrile;hydrochloride. InChIKey: GIWYZIJRRJPYQS-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 4-(aminomethyl)-2-chlorobenzonitrile;hydrochloride |
| InChIKey | GIWYZIJRRJPYQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)Cl)C#N.Cl |
Computed by PubChem (NCBI)