Products 1823182-50-8
CAS 1823182-50-8 is the registry number for N'-(3-Chloropropanoyl)-3-fluorobenzohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
N'-(3-chloropropanoyl)-3-fluorobenzohydrazide (CAS 1823182-50-8) is a chemical compound with the molecular formula C10H10ClFN2O2 and a molecular weight of 244.65 g/mol. IUPAC name: N'-(3-chloropropanoyl)-3-fluorobenzohydrazide. InChIKey: RWOIMFSBXZZCDQ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O2 |
|---|---|
| Molecular weight | 244.65 g/mol |
| IUPAC name | N'-(3-chloropropanoyl)-3-fluorobenzohydrazide |
| InChIKey | RWOIMFSBXZZCDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)NNC(=O)CCCl |
Computed by PubChem (NCBI)