Products 923120-07-4
CAS 923120-07-4 is the registry number for N'-(2-Chloropropanoyl)-4-fluorobenzohydrazide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N'-(2-chloropropanoyl)-4-fluorobenzohydrazide (CAS 923120-07-4) is a chemical compound with the molecular formula C10H10ClFN2O2 and a molecular weight of 244.65 g/mol. IUPAC name: N'-(2-chloropropanoyl)-4-fluorobenzohydrazide. InChIKey: MJFLYPJTJRUMBN-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O2 |
|---|---|
| Molecular weight | 244.65 g/mol |
| IUPAC name | N'-(2-chloropropanoyl)-4-fluorobenzohydrazide |
| InChIKey | MJFLYPJTJRUMBN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NNC(=O)C1=CC=C(C=C1)F)Cl |
Computed by PubChem (NCBI)