CAS 37522-19-3 appears in our catalog under these names: 2-Chloro-2-(4-fluoro-phenyl-hydrazono)-acetic acid ethyl ester, 95%, ethyl (2Z)-2-chloro-2-[2-(4-fluorophenyl)hydrazin-1-ylidene]acetate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g.
Ethyl (2Z)-2-chloro-2-[(4-fluorophenyl)hydrazinylidene]acetate (CAS 37522-19-3) is a chemical compound with the molecular formula C10H10ClFN2O2 and a molecular weight of 244.65 g/mol. IUPAC name: ethyl (2Z)-2-chloro-2-[(4-fluorophenyl)hydrazinylidene]acetate. InChIKey: VVERUMZUZIFIQN-ZROIWOOFSA-N.
| Molecular formula | C10H10ClFN2O2 |
|---|---|
| Molecular weight | 244.65 g/mol |
| IUPAC name | ethyl (2Z)-2-chloro-2-[(4-fluorophenyl)hydrazinylidene]acetate |
| InChIKey | VVERUMZUZIFIQN-ZROIWOOFSA-N |
| SMILES | CCOC(=O)/C(=N/NC1=CC=C(C=C1)F)/Cl |
Computed by PubChem (NCBI)