CAS 2229137-64-6 is the registry number for 2-((4-Cyano-2-fluorophenyl)(methyl)amino)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(4-cyano-2-fluoro-N-methylanilino)acetic acid;hydrochloride (CAS 2229137-64-6) is a chemical compound with the molecular formula C10H10ClFN2O2 and a molecular weight of 244.65 g/mol. IUPAC name: 2-(4-cyano-2-fluoro-N-methylanilino)acetic acid;hydrochloride. InChIKey: NJVOMUKFSBTMBV-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFN2O2 |
|---|---|
| Molecular weight | 244.65 g/mol |
| IUPAC name | 2-(4-cyano-2-fluoro-N-methylanilino)acetic acid;hydrochloride |
| InChIKey | NJVOMUKFSBTMBV-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1=C(C=C(C=C1)C#N)F.Cl |
Computed by PubChem (NCBI)