CAS 1823264-51-2 appears in our catalog under these names: 2-tert-Butyl 8-methyl 5-thia-2-azaspiro(3.4)octane-2,8-dicarboxylate, 98%, 2–tert–Butyl 8–methyl 5–thia–2–azaspiro(3·4)octane–2,8–dicarboxylate, 2-(tert-Butyl) 8-methyl 5-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate, 98%, 2-tert-butyl 8-methyl 5-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate, 98%, 98%. Offered by: AmBeed, GLPBio, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 50mg, 250mg, 1g.
2-O-tert-butyl 8-O-methyl 5-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate (CAS 1823264-51-2) is a chemical compound with the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. IUPAC name: 2-O-tert-butyl 8-O-methyl 5-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate. InChIKey: KYXIKMLKKOXNGZ-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4S |
|---|---|
| Molecular weight | 287.38 g/mol |
| IUPAC name | 2-O-tert-butyl 8-O-methyl 5-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate |
| InChIKey | KYXIKMLKKOXNGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(CCS2)C(=O)OC |
Computed by PubChem (NCBI)