CAS 2414476-36-9 appears in our catalog under these names: rel-(3R,4R)-4-Methylpiperidin-3-ol 4-methylbenzenesulfonate, 97%, 4-methylbenzenesulfonic acid,cis-4-methylpiperidin-3-ol, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
4-methylbenzenesulfonic acid;(3R,4R)-4-methylpiperidin-3-ol (CAS 2414476-36-9) is a chemical compound with the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;(3R,4R)-4-methylpiperidin-3-ol. InChIKey: JUIRPJICWDLKNI-BCBTXJGPSA-N.
| Molecular formula | C13H21NO4S |
|---|---|
| Molecular weight | 287.38 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;(3R,4R)-4-methylpiperidin-3-ol |
| InChIKey | JUIRPJICWDLKNI-BCBTXJGPSA-N |
| SMILES | C[C@@H]1CCNC[C@@H]1O.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)