CAS 2504148-12-1 is the registry number for (2R,5S)-2,5-Dimethylmorpholine 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2R,5S)-2,5-dimethylmorpholine;4-methylbenzenesulfonic acid (CAS 2504148-12-1) is a chemical compound with the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. IUPAC name: (2R,5S)-2,5-dimethylmorpholine;4-methylbenzenesulfonic acid. InChIKey: OWLQUTOIMRWTKV-WSMZBUKVSA-N.
| Molecular formula | C13H21NO4S |
|---|---|
| Molecular weight | 287.38 g/mol |
| IUPAC name | (2R,5S)-2,5-dimethylmorpholine;4-methylbenzenesulfonic acid |
| InChIKey | OWLQUTOIMRWTKV-WSMZBUKVSA-N |
| SMILES | C[C@@H]1CN[C@H](CO1)C.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)