CAS 1858251-93-0 is the registry number for tert-Butyl 2-thia-8-azaspiro[4.5]dec-3-ene-8-carboxylate 2,2-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Tert-butyl 2,2-dioxo-2lambda6-thia-8-azaspiro[4.5]dec-3-ene-8-carboxylate (CAS 1858251-93-0) is a chemical compound with the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. IUPAC name: tert-butyl 2,2-dioxo-2lambda6-thia-8-azaspiro[4.5]dec-3-ene-8-carboxylate. InChIKey: RVNMDGPXZLMTSG-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4S |
|---|---|
| Molecular weight | 287.38 g/mol |
| IUPAC name | tert-butyl 2,2-dioxo-2lambda6-thia-8-azaspiro[4.5]dec-3-ene-8-carboxylate |
| InChIKey | RVNMDGPXZLMTSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CS(=O)(=O)C=C2 |
Computed by PubChem (NCBI)