Products 1823310-95-7
CAS 1823310-95-7 is the registry number for tert-Butyl 3-(5-amino-1,3,4-oxadiazol-2-yl)azetidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3-(5-amino-1,3,4-oxadiazol-2-yl)azetidine-1-carboxylate (CAS 1823310-95-7) is a chemical compound with the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. IUPAC name: tert-butyl 3-(5-amino-1,3,4-oxadiazol-2-yl)azetidine-1-carboxylate. InChIKey: WUAHDMPIDVMBKR-UHFFFAOYSA-N.
| Molecular formula | C10H16N4O3 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | tert-butyl 3-(5-amino-1,3,4-oxadiazol-2-yl)azetidine-1-carboxylate |
| InChIKey | WUAHDMPIDVMBKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)