Products 1823320-23-5
CAS 1823320-23-5 appears in our catalog under these names: 4,4’-Dimethylaminorex Hydrochloride, 4,4-Dimethylaminorex hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 50mg, 100mg.
4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine;hydrochloride (CAS 1823320-23-5) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: 4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine;hydrochloride. InChIKey: OEXHLELNSSWODA-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | 4-methyl-5-(4-methylphenyl)-4,5-dihydro-1,3-oxazol-2-amine;hydrochloride |
| InChIKey | OEXHLELNSSWODA-UHFFFAOYSA-N |
| SMILES | CC1C(OC(=N1)N)C2=CC=C(C=C2)C.Cl |
Computed by PubChem (NCBI)