CAS 1823339-64-5 is the registry number for (5-Benzyl-1,2-oxazol-3-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(5-benzyl-1,2-oxazol-3-yl)methanol (CAS 1823339-64-5) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: (5-benzyl-1,2-oxazol-3-yl)methanol. InChIKey: BVEXWODGPYRATK-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (5-benzyl-1,2-oxazol-3-yl)methanol |
| InChIKey | BVEXWODGPYRATK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=NO2)CO |
Computed by PubChem (NCBI)