Products 1823344-44-0
CAS 1823344-44-0 is the registry number for 2-(1-Chloroethyl)-5-(trifluoromethyl)pyridine, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
2-(1-chloroethyl)-5-(trifluoromethyl)pyridine (CAS 1823344-44-0) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: 2-(1-chloroethyl)-5-(trifluoromethyl)pyridine. InChIKey: IVSODDQQUJGPOB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 2-(1-chloroethyl)-5-(trifluoromethyl)pyridine |
| InChIKey | IVSODDQQUJGPOB-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)