CAS 1823419-92-6 is the registry number for 3-Chloro-4-ethoxy-2-fluoro benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3-chloro-4-ethoxy-2-fluorobenzoic acid (CAS 1823419-92-6) is a chemical compound with the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. IUPAC name: 3-chloro-4-ethoxy-2-fluorobenzoic acid. InChIKey: KEAORQIJZGUXQH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO3 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | 3-chloro-4-ethoxy-2-fluorobenzoic acid |
| InChIKey | KEAORQIJZGUXQH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C(=O)O)F)Cl |
Computed by PubChem (NCBI)