Products 2385350-59-2
CAS 2385350-59-2 is the registry number for 6-Chloro-3-ethoxy-2-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
6-chloro-3-ethoxy-2-fluorobenzoic acid (CAS 2385350-59-2) is a chemical compound with the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. IUPAC name: 6-chloro-3-ethoxy-2-fluorobenzoic acid. InChIKey: HHVWJNPQOHXQJX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO3 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | 6-chloro-3-ethoxy-2-fluorobenzoic acid |
| InChIKey | HHVWJNPQOHXQJX-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)Cl)C(=O)O)F |
Computed by PubChem (NCBI)