CAS 2179038-43-6 appears in our catalog under these names: 6-Fluoro-2-chloro-3-(methoxymethoxy)benzaldehyde, 95%, 2-Chloro-6-fluoro-3-(methoxymethoxy)benzaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-chloro-6-fluoro-3-(methoxymethoxy)benzaldehyde (CAS 2179038-43-6) is a chemical compound with the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. IUPAC name: 2-chloro-6-fluoro-3-(methoxymethoxy)benzaldehyde. InChIKey: RPODJWYXVDATDW-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO3 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | 2-chloro-6-fluoro-3-(methoxymethoxy)benzaldehyde |
| InChIKey | RPODJWYXVDATDW-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)F)C=O)Cl |
Computed by PubChem (NCBI)