Products 2112387-97-8
CAS 2112387-97-8 is the registry number for Methyl 5-chloro-4-fluoro-2-methoxybenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 5-chloro-4-fluoro-2-methoxybenzoate (CAS 2112387-97-8) is a chemical compound with the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. IUPAC name: methyl 5-chloro-4-fluoro-2-methoxybenzoate. InChIKey: DXJYCYYSYPKELG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO3 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | methyl 5-chloro-4-fluoro-2-methoxybenzoate |
| InChIKey | DXJYCYYSYPKELG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)Cl)F |
Computed by PubChem (NCBI)