Products 182344-65-6
CAS 182344-65-6 appears in our catalog under these names: 6-Bromo-2-(2-(dimethylamino)ethyl)-1H-benz(de)isoquinoline-1,3(2H)-dione, 95-<97%, 6-Bromo-2-(2-(dimethylamino)ethyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione, 95%, 95%. Offered by: Hoffman Fine Chemicals, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 1g, 5g.
6-bromo-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione (CAS 182344-65-6) is a chemical compound with the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. IUPAC name: 6-bromo-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione. InChIKey: MODSUWWQETUFGJ-UHFFFAOYSA-N.
| Molecular formula | C16H15BrN2O2 |
|---|---|
| Molecular weight | 347.21 g/mol |
| IUPAC name | 6-bromo-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione |
| InChIKey | MODSUWWQETUFGJ-UHFFFAOYSA-N |
| SMILES | CN(C)CCN1C(=O)C2=C3C(=C(C=C2)Br)C=CC=C3C1=O |
Computed by PubChem (NCBI)