Products 86017-98-3
CAS 86017-98-3 is the registry number for Bromocriptine mesilate Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
(6aR,9S)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid (CAS 86017-98-3) is a chemical compound with the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. IUPAC name: (6aR,9S)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid. InChIKey: IPSOSLBLNUSDJQ-ISVAXAHUSA-N.
| Molecular formula | C16H15BrN2O2 |
|---|---|
| Molecular weight | 347.21 g/mol |
| IUPAC name | (6aR,9S)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid |
| InChIKey | IPSOSLBLNUSDJQ-ISVAXAHUSA-N |
| SMILES | CN1C[C@H](C=C2[C@H]1CC3=C(NC4=CC=CC2=C34)Br)C(=O)O |
Computed by PubChem (NCBI)