Products 478-83-1
CAS 478-83-1 appears in our catalog under these names: Bromocriptine mesilate EP Impurity D, Bromocriptine EP Impurity D, 2-Bromolysergic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(6aR,9R)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid (CAS 478-83-1) is a chemical compound with the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. IUPAC name: (6aR,9R)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid. InChIKey: IPSOSLBLNUSDJQ-AMIZOPFISA-N.
| Molecular formula | C16H15BrN2O2 |
|---|---|
| Molecular weight | 347.21 g/mol |
| IUPAC name | (6aR,9R)-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylic acid |
| InChIKey | IPSOSLBLNUSDJQ-AMIZOPFISA-N |
| SMILES | CN1C[C@@H](C=C2[C@H]1CC3=C(NC4=CC=CC2=C34)Br)C(=O)O |
Computed by PubChem (NCBI)