Products 2173253-12-6
CAS 2173253-12-6 is the registry number for 4-(2-Bromo-5-methoxyphenyl)-1,3,4,5-tetrahydro-2H-benzo[b][1,4]diazepin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromo-5-methoxyphenyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (CAS 2173253-12-6) is a chemical compound with the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. IUPAC name: 2-(2-bromo-5-methoxyphenyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one. InChIKey: CHMBFAQNSGLETL-UHFFFAOYSA-N.
| Molecular formula | C16H15BrN2O2 |
|---|---|
| Molecular weight | 347.21 g/mol |
| IUPAC name | 2-(2-bromo-5-methoxyphenyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| InChIKey | CHMBFAQNSGLETL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)C2CC(=O)NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)