Products 1823464-54-5

CAS 1823464-54-5 appears in our catalog under these names: 2-(4-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)acetic acid, 95%, 2-(4-Methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid (CAS 1823464-54-5) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 2-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid. InChIKey: URYBQPIPDBWRIK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7F3N2O2
Molecular weight208.14 g/mol
IUPAC name2-[4-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid
InChIKeyURYBQPIPDBWRIK-UHFFFAOYSA-N
SMILESCC1=CN(N=C1C(F)(F)F)CC(=O)O

Computed by PubChem (NCBI)