Products 1823505-57-2

CAS 1823505-57-2 is the registry number for Cis/trans (4-benzyloxycarbonylamino-cyclohexyl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[4-(phenylmethoxycarbonylamino)cyclohexyl]acetic acid (CAS 1823505-57-2) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 2-[4-(phenylmethoxycarbonylamino)cyclohexyl]acetic acid. InChIKey: GKNYYSXDGOGFJC-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21NO4
Molecular weight291.34 g/mol
IUPAC name2-[4-(phenylmethoxycarbonylamino)cyclohexyl]acetic acid
InChIKeyGKNYYSXDGOGFJC-UHFFFAOYSA-N
SMILESC1CC(CCC1CC(=O)O)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)