Products 182352-59-6
CAS 182352-59-6 appears in our catalog under these names: 1–Boc–pyrrolidine–2，4–dione, 1-Boc-pyrrolidine-2,4-dione, tert-Butyl 2,4-dioxopyrrolidine-1-carboxylate 95%, tert-Butyl 2,4-dioxopyrrolidine-1-carboxylate, 97%, 97%, tert-Butyl 2,4-dioxopyrrolidine-1-carboxylate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 500g, 100g.
Tert-butyl 2,4-dioxopyrrolidine-1-carboxylate (CAS 182352-59-6) is a chemical compound with the molecular formula C9H13NO4 and a molecular weight of 199.20 g/mol. IUPAC name: tert-butyl 2,4-dioxopyrrolidine-1-carboxylate. InChIKey: JWMCWFLHZICZQD-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | tert-butyl 2,4-dioxopyrrolidine-1-carboxylate |
| InChIKey | JWMCWFLHZICZQD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC1=O |
Computed by PubChem (NCBI)