Products 1824190-01-3
CAS 1824190-01-3 is the registry number for Methyl 3,4-dihydrospiro(1,4-benzoxazine-2,1'-cyclopropane)-6-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl spiro[3,4-dihydro-1,4-benzoxazine-2,1'-cyclopropane]-6-carboxylate (CAS 1824190-01-3) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: methyl spiro[3,4-dihydro-1,4-benzoxazine-2,1'-cyclopropane]-6-carboxylate. InChIKey: BAMUFTFPQBXURM-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | methyl spiro[3,4-dihydro-1,4-benzoxazine-2,1'-cyclopropane]-6-carboxylate |
| InChIKey | BAMUFTFPQBXURM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OC3(CC3)CN2 |
Computed by PubChem (NCBI)