CAS 1824414-35-8 appears in our catalog under these names: 7-(tert-Butoxycarbonyl)-3-oxo-7-azabicyclo(2.2.1)heptane-1-carboxylic acid, 97%, 7-(tert-Butoxycarbonyl)-3-oxo-7-azabicyclo[2.2.1]heptane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
7-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxo-7-azabicyclo[2.2.1]heptane-1-carboxylic acid (CAS 1824414-35-8) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxo-7-azabicyclo[2.2.1]heptane-1-carboxylic acid. InChIKey: BSTZJNFIHJNFQF-UHFFFAOYSA-N.
| Molecular formula | C12H17NO5 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxo-7-azabicyclo[2.2.1]heptane-1-carboxylic acid |
| InChIKey | BSTZJNFIHJNFQF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1(CC2=O)C(=O)O |
Computed by PubChem (NCBI)