Products 1824511-18-3

CAS 1824511-18-3 is the registry number for 3-Boc-4-isopropyl-1,2,3-oxathiazolidine 2,2-dioxide, 98%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate (CAS 1824511-18-3) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: tert-butyl 2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate. InChIKey: FWEXSIHWPAKSOP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19NO5S
Molecular weight265.33 g/mol
IUPAC nametert-butyl 2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate
InChIKeyFWEXSIHWPAKSOP-UHFFFAOYSA-N
SMILESCC(C)C1COS(=O)(=O)N1C(=O)OC(C)(C)C

Computed by PubChem (NCBI)