CAS 1824511-18-3 is the registry number for 3-Boc-4-isopropyl-1,2,3-oxathiazolidine 2,2-dioxide, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl 2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate (CAS 1824511-18-3) is a chemical compound with the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. IUPAC name: tert-butyl 2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate. InChIKey: FWEXSIHWPAKSOP-UHFFFAOYSA-N.
| Molecular formula | C10H19NO5S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | tert-butyl 2,2-dioxo-4-propan-2-yloxathiazolidine-3-carboxylate |
| InChIKey | FWEXSIHWPAKSOP-UHFFFAOYSA-N |
| SMILES | CC(C)C1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)