Products 1824791-86-7
CAS 1824791-86-7 is the registry number for N-[1,1,1-Trifluoro-3-(pyridin-2-yl)propan-2-ylidene]hydroxylamine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(NE)-N-(1,1,1-trifluoro-3-pyridin-2-ylpropan-2-ylidene)hydroxylamine (CAS 1824791-86-7) is a chemical compound with the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. IUPAC name: (NE)-N-(1,1,1-trifluoro-3-pyridin-2-ylpropan-2-ylidene)hydroxylamine. InChIKey: HMHQHUNAOJUMDW-NTUHNPAUSA-N.
| Molecular formula | C8H7F3N2O |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | (NE)-N-(1,1,1-trifluoro-3-pyridin-2-ylpropan-2-ylidene)hydroxylamine |
| InChIKey | HMHQHUNAOJUMDW-NTUHNPAUSA-N |
| SMILES | C1=CC=NC(=C1)C/C(=N\O)/C(F)(F)F |
Computed by PubChem (NCBI)