Products 1824969-10-9
CAS 1824969-10-9 is the registry number for (1S,3R)-3-((2S)-2-Phenylpropanamido)cyclopentane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Cis-(1S,3R)-3-[[(2S)-2-phenylpropanoyl]amino]cyclopentane-1-carboxylic acid (CAS 1824969-10-9) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: cis-(1S,3R)-3-[[(2S)-2-phenylpropanoyl]amino]cyclopentane-1-carboxylic acid. InChIKey: MUGAXCAKQYFGOG-WCFLWFBJSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | cis-(1S,3R)-3-[[(2S)-2-phenylpropanoyl]amino]cyclopentane-1-carboxylic acid |
| InChIKey | MUGAXCAKQYFGOG-WCFLWFBJSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)C(=O)N[C@@H]2CC[C@@H](C2)C(=O)O |
Computed by PubChem (NCBI)