Products 1938289-59-8
CAS 1938289-59-8 is the registry number for (1R,3S)-3-((2R)-2-Phenylpropanamido)cyclopentane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1R,3S)-3-[[(2R)-2-phenylpropanoyl]amino]cyclopentane-1-carboxylic acid (CAS 1938289-59-8) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: cis-(1R,3S)-3-[[(2R)-2-phenylpropanoyl]amino]cyclopentane-1-carboxylic acid. InChIKey: MUGAXCAKQYFGOG-RTXFEEFZSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | cis-(1R,3S)-3-[[(2R)-2-phenylpropanoyl]amino]cyclopentane-1-carboxylic acid |
| InChIKey | MUGAXCAKQYFGOG-RTXFEEFZSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)C(=O)N[C@H]2CC[C@H](C2)C(=O)O |
Computed by PubChem (NCBI)