CAS 182509-19-9 is the registry number for Trans-1-((tert-butoxy)carbonyl)-4-methylpiperidine-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2R,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 182509-19-9) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2R,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: LTNNUMKAWAGPIS-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2R,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | LTNNUMKAWAGPIS-RKDXNWHRSA-N |
| SMILES | C[C@@H]1CCN([C@H](C1)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)