CAS 187752-72-3 appears in our catalog under these names: (2R,4S)-rel-4-Methyl-1,2-piperidinedicarboxylic Acid 1-(1,1-Dimethylethyl) Ester, cis-1-(tert-Butoxycarbonyl)-4-methylpiperidine-2-carboxylic acid, 97%, cis-1-(tert-Butoxycarbonyl)-4-methylpiperidine-2-carboxylic acid, 97%, 97%. Offered by: TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g.
(2S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 187752-72-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: LTNNUMKAWAGPIS-BDAKNGLRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | LTNNUMKAWAGPIS-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CCN([C@@H](C1)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)