CAS 18252-44-3 is the registry number for (±)-beta-Copaene. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decane (CAS 18252-44-3) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1R,2S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decane. InChIKey: UPVZPMJSRSWJHQ-QBXMUUHRSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1R,2S)-1-methyl-3-methylidene-8-propan-2-yltricyclo[4.4.0.02,7]decane |
| InChIKey | UPVZPMJSRSWJHQ-QBXMUUHRSA-N |
| SMILES | CC(C)C1CC[C@]2([C@H]3C1C2CCC3=C)C |
Computed by PubChem (NCBI)